CAS 1017781-38-2
:3-(4-Iodophenyl)-1-(1-methylethyl)-1H-pyrazol-5-amine
Description:
3-(4-Iodophenyl)-1-(1-methylethyl)-1H-pyrazol-5-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-iodophenyl group indicates that there is an iodine atom attached to a phenyl ring at the para position, contributing to the compound's potential for biological activity and reactivity. The isopropyl group (1-methylethyl) attached to the pyrazole ring enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the iodine substituent. It may also participate in hydrogen bonding due to the amine functional group, which can affect its interactions in biological systems. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C12H14IN3
InChI:InChI=1S/C12H14IN3/c1-8(2)16-12(14)7-11(15-16)9-3-5-10(13)6-4-9/h3-8H,14H2,1-2H3
InChI key:InChIKey=PMLMUNXQCUYBTL-UHFFFAOYSA-N
SMILES:C(C)(C)N1N=C(C=C1N)C2=CC=C(I)C=C2
Synonyms:- 1H-Pyrazol-5-amine, 3-(4-iodophenyl)-1-(1-methylethyl)-
- 3-(4-Iodophenyl)-1-(1-methylethyl)-1H-pyrazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
