
CAS 1017781-55-3
:1-[4-(Aminomethyl)phenyl]-2-(4-methoxyphenyl)ethanone
Description:
1-[4-(Aminomethyl)phenyl]-2-(4-methoxyphenyl)ethanone, identified by its CAS number 1017781-55-3, is an organic compound characterized by its complex structure, which includes an ethanone moiety substituted with both an aminomethyl group and a methoxyphenyl group. This compound typically exhibits properties associated with aromatic amines and ketones, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The aminomethyl group can participate in hydrogen bonding and may influence the compound's biological activity, while the methoxy group can affect its electronic properties and steric hindrance. The presence of these substituents suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c1-19-15-8-4-12(5-9-15)10-16(18)14-6-2-13(11-17)3-7-14/h2-9H,10-11,17H2,1H3
InChI key:InChIKey=JVLWBFIYUUJOCO-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(OC)C=C1)(=O)C2=CC=C(CN)C=C2
Synonyms:- 1-[4-(Aminomethyl)phenyl]-2-(4-methoxyphenyl)ethanone
- Ethanone, 1-[4-(aminomethyl)phenyl]-2-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
