CymitQuimica logo

CAS 1017781-62-2

:

2-Bromo-6-cyclohexylpyridine

Description:
2-Bromo-6-cyclohexylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a cyclohexyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the electronegative bromine and nitrogen atoms, influencing its solubility in various organic solvents. It may participate in electrophilic aromatic substitution reactions due to the bromine substituent, while the cyclohexyl group can provide steric hindrance. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often found in biologically active molecules. Additionally, the presence of the cyclohexyl group may enhance lipophilicity, affecting the compound's bioavailability and interaction with biological targets. Safety data should be consulted for handling and usage, as halogenated compounds can pose health and environmental risks.
Formula:C11H14BrN
InChI:InChI=1S/C11H14BrN/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2
InChI key:InChIKey=JKFSCIIMZPOGKG-UHFFFAOYSA-N
SMILES:BrC1=NC(=CC=C1)C2CCCCC2
Synonyms:
  • 2-Bromo-6-cyclohexylpyridine
  • Pyridine, 2-bromo-6-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.