
CAS 1017781-65-5
:1-[3-(Aminomethyl)phenyl]-2-(4-chlorophenyl)ethanone
Description:
1-[3-(Aminomethyl)phenyl]-2-(4-chlorophenyl)ethanone, identified by its CAS number 1017781-65-5, is an organic compound characterized by its complex structure, which includes an ethanone moiety substituted with both an aminomethyl group and a chlorophenyl group. This compound typically exhibits properties associated with aromatic amines and ketones, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The aminomethyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. The chlorophenyl substituent may impart additional electronic effects, potentially enhancing the compound's biological activity or reactivity in chemical reactions. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development or as intermediates in organic synthesis. Safety and handling considerations are essential, as compounds with amine and halogen functionalities can pose health risks and environmental concerns.
Formula:C15H14ClNO
InChI:InChI=1S/C15H14ClNO/c16-14-6-4-11(5-7-14)9-15(18)13-3-1-2-12(8-13)10-17/h1-8H,9-10,17H2
InChI key:InChIKey=CHCXUQVYPDOBNB-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Cl)C=C1)(=O)C2=CC(CN)=CC=C2
Synonyms:- Ethanone, 1-[3-(aminomethyl)phenyl]-2-(4-chlorophenyl)-
- 1-[3-(Aminomethyl)phenyl]-2-(4-chlorophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
