CAS 1017781-67-7
:1-[3-(Aminomethyl)phenyl]-2-phenylethanone
Description:
1-[3-(Aminomethyl)phenyl]-2-phenylethanone, also known by its CAS number 1017781-67-7, is an organic compound characterized by its structure, which includes a ketone functional group and an amine substituent. This compound features a phenyl group attached to a carbonyl (C=O) moiety, indicating its classification as a ketone. The presence of the aminomethyl group suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The compound's molecular structure contributes to its physical properties, such as solubility and melting point, which can vary based on the presence of functional groups and molecular interactions. Additionally, its potential biological activity may be explored in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, underscoring the importance of proper laboratory practices when working with such substances.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c16-11-13-7-4-8-14(9-13)15(17)10-12-5-2-1-3-6-12/h1-9H,10-11,16H2
InChI key:InChIKey=UQQRLURZYOPSCJ-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(=O)C2=CC(CN)=CC=C2
Synonyms:- 1-[3-(Aminomethyl)phenyl]-2-phenylethanone
- Ethanone, 1-[3-(aminomethyl)phenyl]-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
