CymitQuimica logo

CAS 1017781-68-8

:

4-(5-Chloro-2-pyrazinyl)morpholine

Description:
4-(5-Chloro-2-pyrazinyl)morpholine is a chemical compound characterized by its unique structural features, which include a morpholine ring and a pyrazine moiety substituted with a chlorine atom. The presence of the pyrazine ring contributes to its aromatic properties, while the morpholine ring provides basic nitrogen functionality, making it potentially useful in various chemical reactions and applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of both nitrogen-containing rings. Its molecular structure suggests potential biological activity, which is often explored in pharmaceutical research, particularly in the development of new drugs. The chlorine substituent can influence the compound's reactivity and interaction with biological targets. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 4-(5-Chloro-2-pyrazinyl)morpholine is of interest in both synthetic chemistry and medicinal chemistry fields.
Formula:C8H10ClN3O
InChI:InChI=1S/C8H10ClN3O/c9-7-5-11-8(6-10-7)12-1-3-13-4-2-12/h5-6H,1-4H2
InChI key:InChIKey=QXSXUGFYNHPZFD-UHFFFAOYSA-N
SMILES:ClC=1N=CC(=NC1)N2CCOCC2
Synonyms:
  • Morpholine, 4-(5-chloro-2-pyrazinyl)-
  • 4-(5-Chloro-2-pyrazinyl)morpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.