CAS 1017781-76-8

2-Bromo-6-(1-piperidinyl)pyrazine

Description:

2-Bromo-6-(1-piperidinyl)pyrazine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. The presence of a bromine atom at the 2-position and a piperidinyl group at the 6-position contributes to its unique properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its moderate polarity. It is often utilized in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of neuropharmacology and as a building block for various pharmaceuticals. The piperidinyl substituent may enhance its interaction with biological targets, making it of interest in the synthesis of compounds with specific pharmacological profiles. Safety data should be consulted for handling, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 2-Bromo-6-(1-piperidinyl)pyrazine represents a versatile structure in organic synthesis and medicinal chemistry.

Formula: C₉H₁₂BrN₃

InChI: InChI=1S/C9H12BrN3/c10-8-6-11-7-9(12-8)13-4-2-1-3-5-13/h6-7H,1-5H2

InChI key: InChIKey=ZDWFVRMVDWKICQ-UHFFFAOYSA-N

SMILES: BrC=1N=C(C=NC1)N2CCCCC2

Synonyms:

• Pyrazine, 2-bromo-6-(1-piperidinyl)-
• 2-Bromo-6-(1-piperidinyl)pyrazine