
CAS 1017781-90-6
:3-Chloro-1-(3-pyridinylmethyl)-1H-indazole
Description:
3-Chloro-1-(3-pyridinylmethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro group at the 3-position and a pyridinylmethyl substituent at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the pyridine moiety may enhance its ability to engage in hydrogen bonding and π-π stacking interactions, which are crucial for biological activity. Additionally, the chloro substituent can influence the compound's electronic properties and reactivity, potentially affecting its pharmacokinetic profile. Overall, 3-Chloro-1-(3-pyridinylmethyl)-1H-indazole represents a class of compounds that may have applications in therapeutic contexts, warranting further investigation into its properties and effects.
Formula:C13H10ClN3
InChI:InChI=1S/C13H10ClN3/c14-13-11-5-1-2-6-12(11)17(16-13)9-10-4-3-7-15-8-10/h1-8H,9H2
InChI key:InChIKey=YQMJWQAMAMMOIO-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(Cl)=N1)=CC=CC2)C=3C=CC=NC3
Synonyms:- 3-Chloro-1-(3-pyridinylmethyl)-1H-indazole
- 1H-Indazole, 3-chloro-1-(3-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
