CAS 1017781-91-7
:4,6-Dichloro-2-(1-piperazinyl)pyrimidine
Description:
4,6-Dichloro-2-(1-piperazinyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms at the 4 and 6 positions and a piperazine moiety at the 2 position. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial and antiviral agents. The presence of the piperazine group enhances its ability to interact with biological targets, such as receptors or enzymes. The dichloro substitutions can influence the compound's reactivity and stability, as well as its lipophilicity and overall pharmacokinetic properties. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity. Overall, 4,6-Dichloro-2-(1-piperazinyl)pyrimidine represents a significant compound in medicinal chemistry, with ongoing research into its applications and mechanisms of action.
Formula:C8H10Cl2N4
InChI:InChI=1S/C8H10Cl2N4/c9-6-5-7(10)13-8(12-6)14-3-1-11-2-4-14/h5,11H,1-4H2
InChI key:InChIKey=BNMHSJKRWZNYTF-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC(Cl)=C1)N2CCNCC2
Synonyms:- Pyrimidine, 4,6-dichloro-2-(1-piperazinyl)-
- 4,6-Dichloro-2-(1-piperazinyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
