CymitQuimica logo

CAS 1017781-97-3

:

4-Bromo-6-(1-piperidinyl)pyrimidine

Description:
4-Bromo-6-(1-piperidinyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is substituted at the 4-position with a bromine atom and at the 6-position with a piperidine group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the piperidine ring, which contributes to its basicity and potential for forming hydrogen bonds. The bromine substituent can influence the compound's reactivity, making it suitable for various chemical transformations, including nucleophilic substitutions. Additionally, the presence of the piperidine moiety may enhance its solubility in organic solvents and its interaction with biological targets, suggesting potential applications in medicinal chemistry. The compound's molecular structure allows for various interactions, making it a candidate for research in drug development, particularly in areas targeting specific receptors or enzymes. Overall, 4-Bromo-6-(1-piperidinyl)pyrimidine is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.
Formula:C9H12BrN3
InChI:InChI=1S/C9H12BrN3/c10-8-6-9(12-7-11-8)13-4-2-1-3-5-13/h6-7H,1-5H2
InChI key:InChIKey=JZNWBOVNTVBTCF-UHFFFAOYSA-N
SMILES:BrC1=CC(=NC=N1)N2CCCCC2
Synonyms:
  • 4-Bromo-6-(1-piperidinyl)pyrimidine
  • Pyrimidine, 4-bromo-6-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.