
CAS 1017781-99-5
:3-(3-Piperidinylmethyl)isoquinoline
Description:
3-(3-Piperidinylmethyl)isoquinoline is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of a piperidinylmethyl group at the 3-position of the isoquinoline ring contributes to its potential biological activity. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also possess specific functional groups that influence its reactivity and stability. Additionally, it is important to consider safety and handling precautions, as with many organic compounds, due to potential toxicity or reactivity. Overall, 3-(3-Piperidinylmethyl)isoquinoline represents a class of compounds that could have significant implications in drug discovery and development.
Formula:C15H18N2
InChI:InChI=1S/C15H18N2/c1-2-6-14-11-17-15(9-13(14)5-1)8-12-4-3-7-16-10-12/h1-2,5-6,9,11-12,16H,3-4,7-8,10H2
InChI key:InChIKey=YTFQYMDIMDBTBJ-UHFFFAOYSA-N
SMILES:C(C1=CC2=C(C=N1)C=CC=C2)C3CCCNC3
Synonyms:- Isoquinoline, 3-(3-piperidinylmethyl)-
- 3-(3-Piperidinylmethyl)isoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.