CAS 1017782-05-6
:3-Methyl-1-(1-methylethyl)-4-piperidinamine
Description:
3-Methyl-1-(1-methylethyl)-4-piperidinamine, with the CAS number 1017782-05-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a methyl group and an isopropyl group attached to the nitrogen atom of the piperidine ring, contributing to its unique properties. It is typically classified as an amine due to the presence of the amine functional group, which can influence its reactivity and interactions with other substances. The presence of these alkyl substituents can enhance its lipophilicity, potentially affecting its solubility in organic solvents and biological membranes. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. However, specific applications, safety profiles, and regulatory information would depend on further research and context regarding its use. As with any chemical substance, proper handling and safety precautions are essential when working with 3-Methyl-1-(1-methylethyl)-4-piperidinamine.
Formula:C9H20N2
InChI:InChI=1S/C9H20N2/c1-7(2)11-5-4-9(10)8(3)6-11/h7-9H,4-6,10H2,1-3H3
InChI key:InChIKey=BRBAKJGLGJNFKR-UHFFFAOYSA-N
SMILES:C(C)(C)N1CC(C)C(N)CC1
Synonyms:- 3-Methyl-1-(1-methylethyl)-4-piperidinamine
- 4-Piperidinamine, 3-methyl-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
