CAS 1017782-11-4
:1,1-Dimethylethyl N-(3-amino-6-chloro-2-pyridinyl)carbamate
Description:
1,1-Dimethylethyl N-(3-amino-6-chloro-2-pyridinyl)carbamate, identified by its CAS number 1017782-11-4, is a chemical compound that belongs to the class of carbamates. This substance features a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk and potentially influences its biological activity. The presence of a pyridine ring, specifically substituted with an amino and a chloro group, suggests that it may exhibit specific interactions with biological targets, making it of interest in pharmaceutical research. The carbamate functional group indicates that it may undergo hydrolysis, which can affect its stability and reactivity in various environments. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular structure and the presence of functional groups. Overall, this compound may have applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, due to its unique structural features.
Formula:C10H14ClN3O2
InChI:InChI=1S/C10H14ClN3O2/c1-10(2,3)16-9(15)14-8-6(12)4-5-7(11)13-8/h4-5H,12H2,1-3H3,(H,13,14,15)
InChI key:InChIKey=LAQDJVCVHQSFME-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(N)C=CC(Cl)=N1
Synonyms:- 1,1-Dimethylethyl N-(3-amino-6-chloro-2-pyridinyl)carbamate
- Carbamic acid, N-(3-amino-6-chloro-2-pyridinyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
