CymitQuimica logo

CAS 1017782-19-2

:

2,3,3a,4,5,9b-Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]quinoline

Description:
2,3,3a,4,5,9b-Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]quinoline, with CAS number 1017782-19-2, is a complex organic compound characterized by its bicyclic structure, which incorporates both a pyrrole and a quinoline moiety. This compound features a hexahydro framework, indicating that it contains multiple saturated carbon atoms, contributing to its stability and potential biological activity. The presence of a phenylmethyl group enhances its lipophilicity, which may influence its interaction with biological systems and its solubility in organic solvents. The unique arrangement of its nitrogen atoms within the heterocyclic rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Additionally, the compound's structural features may allow for various functionalizations, making it a candidate for further chemical modifications. Overall, its intricate structure and potential biological relevance make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C18H20N2
InChI:InChI=1S/C18H20N2/c1-2-6-14(7-3-1)11-20-12-15-10-19-18-9-5-4-8-16(18)17(15)13-20/h1-9,15,17,19H,10-13H2
InChI key:InChIKey=APSFVWLHYYFSDW-UHFFFAOYSA-N
SMILES:C(N1CC2C=3C(NCC2C1)=CC=CC3)C4=CC=CC=C4
Synonyms:
  • 1H-Pyrrolo[3,4-c]quinoline, 2,3,3a,4,5,9b-hexahydro-2-(phenylmethyl)-
  • 2,3,3a,4,5,9b-Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.