CymitQuimica logo

CAS 1017782-21-6

:

1,2,3,3a,5,9b-Hexahydro-2-(phenylmethyl)-4H-pyrrolo[3,4-c]quinolin-4-one

Description:
1,2,3,3a,5,9b-Hexahydro-2-(phenylmethyl)-4H-pyrrolo[3,4-c]quinolin-4-one, with CAS number 1017782-21-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a pyrrole and a quinoline moiety. This compound typically exhibits a molecular formula that reflects its intricate arrangement of carbon, hydrogen, and nitrogen atoms. It is often studied for its potential biological activities, including its role in medicinal chemistry, where it may exhibit properties such as anti-inflammatory or neuroprotective effects. The presence of the phenylmethyl group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the compound's stereochemistry and functional groups can significantly affect its reactivity and interactions with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it a subject of interest in both synthetic and applied chemistry research.
Formula:C18H18N2O
InChI:InChI=1S/C18H18N2O/c21-18-16-12-20(10-13-6-2-1-3-7-13)11-15(16)14-8-4-5-9-17(14)19-18/h1-9,15-16H,10-12H2,(H,19,21)
InChI key:InChIKey=QDCNAGJMBCPFPL-UHFFFAOYSA-N
SMILES:O=C1C2C(C=3C(N1)=CC=CC3)CN(CC4=CC=CC=C4)C2
Synonyms:
  • 1,2,3,3a,5,9b-Hexahydro-2-(phenylmethyl)-4H-pyrrolo[3,4-c]quinolin-4-one
  • 4H-Pyrrolo[3,4-c]quinolin-4-one, 1,2,3,3a,5,9b-hexahydro-2-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.