CAS 1017782-48-7

Ethyl 1-(4-amino-3-methoxyphenyl)-4-piperidinecarboxylate

Description:

Ethyl 1-(4-amino-3-methoxyphenyl)-4-piperidinecarboxylate, identified by its CAS number 1017782-48-7, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a methoxy-substituted phenyl ring. This compound features a piperidine ring, which contributes to its potential biological activity. The presence of the amino and methoxy groups suggests that it may exhibit polar characteristics, influencing its solubility in various solvents. Ethyl 1-(4-amino-3-methoxyphenyl)-4-piperidinecarboxylate may be of interest in medicinal chemistry due to its structural motifs that are often associated with pharmacological properties. Its synthesis typically involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other reagents. Safety data and handling precautions should be consulted when working with this substance.

Formula: C₁₅H₂₂N₂O₃

InChI: InChI=1S/C15H22N2O3/c1-3-20-15(18)11-6-8-17(9-7-11)12-4-5-13(16)14(10-12)19-2/h4-5,10-11H,3,6-9,16H2,1-2H3

InChI key: InChIKey=WJDCJCREJOUQAJ-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1N)N2CCC(C(OCC)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(4-amino-3-methoxyphenyl)-, ethyl ester
• Ethyl 1-(4-amino-3-methoxyphenyl)-4-piperidinecarboxylate