CAS 1017782-51-2

5-Chloro-N-methyl-2-benzoxazolemethanamine

Description:

5-Chloro-N-methyl-2-benzoxazolemethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an amine functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzoxazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The chlorine substituent at the 5-position of the benzoxazole ring can influence the compound's reactivity and solubility, potentially enhancing its interaction with biological targets. As an amine, it may also participate in hydrogen bonding, affecting its solubility in various solvents. The compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for a comprehensive understanding of its characteristics.

Formula: C₉H₉ClN₂O

InChI: InChI=1S/C9H9ClN2O/c1-11-5-9-12-7-4-6(10)2-3-8(7)13-9/h2-4,11H,5H2,1H3

InChI key: InChIKey=UTUDOEKMJVZXSM-UHFFFAOYSA-N

SMILES: C(NC)C1=NC=2C(O1)=CC=C(Cl)C2

Synonyms:

• 5-Chloro-N-methyl-2-benzoxazolemethanamine
• 2-Benzoxazolemethanamine, 5-chloro-N-methyl-

[(5-Chloro-1,3-benzoxazol-2-yl)methyl](methyl)amine

CAS: 1017782-51-2

[(5-Chloro-1,3-benzoxazol-2-yl)methyl](methyl)amine

Purity: 97%

Molecular weight: 196.63g/mol

Ref: 54-OR33470