CAS 1017782-52-3

5-(4-Chlorophenyl)-N-methyl-1,3,4-oxadiazole-2-methanamine

Description:

5-(4-Chlorophenyl)-N-methyl-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound features a methyl group attached to the nitrogen atom of the oxadiazole, which can affect its pharmacokinetic properties. The oxadiazole moiety is known for its role in various medicinal chemistry applications, often exhibiting antimicrobial, anti-inflammatory, or anticancer properties. The compound's molecular structure suggests it may participate in hydrogen bonding due to the amine group, which can enhance its solubility in polar solvents. Additionally, the presence of chlorine may impart specific electronic effects, potentially modulating the compound's reactivity and biological activity. Overall, 5-(4-Chlorophenyl)-N-methyl-1,3,4-oxadiazole-2-methanamine represents a class of compounds that could be of interest in drug discovery and development.

Formula: C₁₀H₁₀ClN₃O

InChI: InChI=1S/C10H10ClN3O/c1-12-6-9-13-14-10(15-9)7-2-4-8(11)5-3-7/h2-5,12H,6H2,1H3

InChI key: InChIKey=CGESIXVBLHONGT-UHFFFAOYSA-N

SMILES: C(NC)C=1OC(=NN1)C2=CC=C(Cl)C=C2

Synonyms:

• 1,3,4-Oxadiazole-2-methanamine, 5-(4-chlorophenyl)-N-methyl-
• 1-[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine
• [[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl](methyl)amine
• 5-(4-Chlorophenyl)-N-methyl-1,3,4-oxadiazole-2-methanamine

{[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl}(methyl)amine

CAS: 1017782-52-3

{[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl}(methyl)amine

Purity: 95%

Molecular weight: 223.66g/mol

Ref: 54-OR33471