
CAS 1017782-62-5
:4-(4-Bromophenyl)-5-(methylsulfonyl)-2-thiazolamine
Description:
4-(4-Bromophenyl)-5-(methylsulfonyl)-2-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The methylsulfonyl group contributes to its solubility and potential interactions in biological systems. This compound may exhibit various properties such as being a potential pharmaceutical agent, given its structural features that are often associated with biological activity. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its function in biological systems. Additionally, the presence of the thiazole moiety often correlates with antimicrobial and anti-inflammatory properties. However, specific applications and safety profiles would depend on further empirical studies and evaluations.
Formula:C10H9BrN2O2S2
InChI:InChI=1S/C10H9BrN2O2S2/c1-17(14,15)9-8(13-10(12)16-9)6-2-4-7(11)5-3-6/h2-5H,1H3,(H2,12,13)
InChI key:InChIKey=VPCJEZJIASXALE-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(N=C(N)S1)C2=CC=C(Br)C=C2
Synonyms:- 4-(4-Bromophenyl)-5-(methylsulfonyl)-2-thiazolamine
- 2-Thiazolamine, 4-(4-bromophenyl)-5-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.