CAS 1017782-64-7: 5-Bromo-2-chloro-3-(chloromethyl)pyridine

Description:5-Bromo-2-chloro-3-(chloromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple halogen substituents, specifically bromine and chlorine, which can significantly influence its reactivity and physical properties. The presence of the chloromethyl group enhances its potential for further chemical modifications, making it a valuable intermediate in organic synthesis. Typically, such halogenated pyridines exhibit properties like increased lipophilicity and potential biological activity, which can be explored in medicinal chemistry. The compound's molecular structure contributes to its stability and solubility in various organic solvents. Additionally, due to the presence of multiple halogens, it may exhibit unique reactivity patterns, such as nucleophilic substitution or coupling reactions. Safety considerations are essential when handling this compound, as halogenated organic compounds can pose environmental and health risks. Overall, 5-Bromo-2-chloro-3-(chloromethyl)pyridine is a significant compound in the realm of synthetic organic chemistry.

Formula:C₆H₄BrCl₂N

InChI:InChI=1S/C6H4BrCl2N/c7-5-1-4(2-8)6(9)10-3-5/h1,3H,2H2

InChI key:InChIKey=VRZYGANTKSIVBU-UHFFFAOYSA-N

SMILES:ClC1=NC=C(Br)C=C1CCl

Synonyms:
Pyridine, 5-bromo-2-chloro-3-(chloromethyl)-
5-Bromo-2-chloro-3-(chloromethyl)pyridine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Pyridine, 5-bromo-2-chloro-3-(chloromethyl)- REF: IN-DA0005JLCAS: 1017782-64-7	95%	166.00 €~647.00 €	Mon 03 Mar 25
5-Bromo-2-chloro-3-(chloromethyl)pyridine REF: 10-F765409CAS: 1017782-64-7	98%	94.00 €~659.00 €	Thu 06 Mar 25
5-Bromo-2-chloro-3-(chloromethyl)pyridine REF: 54-OR14812CAS: 1017782-64-7	- - -	112.00 €~854.00 €	Mon 10 Mar 25
5-Bromo-2-chloro-3-(chloromethyl)pyridine REF: 3D-SQB78264CAS: 1017782-64-7	Min. 95%	To inquire	Mon 14 Apr 25