CAS 1017782-70-5: Phenylmethyl 4-[[(2-bromoethyl)[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-1-piperazinecarboxylate

Description:Phenylmethyl 4-[[[2-bromoethyl][(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-1-piperazinecarboxylate, identified by its CAS number 1017782-70-5, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring, a sulfonamide group, and a bromoethyl moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, and may also demonstrate interactions with biological targets due to its piperazine component. The presence of the dimethylethoxycarbonyl group suggests that it may have protective or modifying roles in chemical reactions or biological interactions. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in pharmaceutical or chemical research. As with many synthetic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula:C₁₉H₂₈BrN₃O₆S

InChI:InChI=1S/C19H28BrN3O6S/c1-19(2,3)29-18(25)23(10-9-20)30(26,27)22-13-11-21(12-14-22)17(24)28-15-16-7-5-4-6-8-16/h4-8H,9-15H2,1-3H3

InChI key:InChIKey=SZYUVMBYYLCPKK-UHFFFAOYSA-N

SMILES:O=C(OCC=1C=CC=CC1)N2CCN(CC2)S(=O)(=O)N(C(=O)OC(C)(C)C)CCBr

Synonyms:
1-Piperazinecarboxylic acid, 4-[[(2-bromoethyl)[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-, phenylmethyl ester
Phenylmethyl 4-[[(2-bromoethyl)[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-1-piperazinecarboxylate