CymitQuimica logo

CAS 1017782-73-8

:

Phenylmethyl N-[(3-chlorophenyl)(phenylsulfonyl)methyl]carbamate

Description:
Phenylmethyl N-[(3-chlorophenyl)(phenylsulfonyl)methyl]carbamate, identified by its CAS number 1017782-73-8, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group. This compound features a phenylmethyl moiety linked to a sulfonyl group, which is further substituted with a 3-chlorophenyl group. The presence of the sulfonyl group often imparts unique chemical properties, such as increased solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active ingredients in agrochemicals. The chlorophenyl substitution can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the carbamate group is known for its ability to undergo hydrolysis, which can affect the stability and reactivity of the compound in various environments. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry and material science, although specific properties such as melting point, solubility, and reactivity would require empirical data for precise characterization.
Formula:C21H18ClNO4S
InChI:InChI=1S/C21H18ClNO4S/c22-18-11-7-10-17(14-18)20(28(25,26)19-12-5-2-6-13-19)23-21(24)27-15-16-8-3-1-4-9-16/h1-14,20H,15H2,(H,23,24)
InChI key:InChIKey=QZAUJXSQDZWJSB-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)C1=CC=CC=C1)(NC(OCC2=CC=CC=C2)=O)C3=CC(Cl)=CC=C3
Synonyms:
  • Carbamic acid, N-[(3-chlorophenyl)(phenylsulfonyl)methyl]-, phenylmethyl ester
  • Phenylmethyl N-[(3-chlorophenyl)(phenylsulfonyl)methyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.