CAS 1017782-74-9

4-Chloro-2-methyl-6-[4-(phenylmethyl)-1-piperazinyl]pyrimidine

Description:

4-Chloro-2-methyl-6-[4-(phenylmethyl)-1-piperazinyl]pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position and a methyl group at the 2-position contributes to its unique reactivity and solubility properties. The compound also features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, linked to a phenylmethyl group, enhancing its potential for biological activity. This structure suggests that the compound may exhibit pharmacological properties, possibly acting as a ligand for various receptors or enzymes. Its molecular structure allows for interactions with biological systems, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrimidine and piperazine rings, which may affect its application in drug development or other chemical processes.

Formula: C₁₆H₁₉ClN₄

InChI: InChI=1S/C16H19ClN4/c1-13-18-15(17)11-16(19-13)21-9-7-20(8-10-21)12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3

InChI key: InChIKey=IOKPDSNVJVSREP-UHFFFAOYSA-N

SMILES: ClC1=CC(=NC(C)=N1)N2CCN(CC3=CC=CC=C3)CC2

Synonyms:

• Pyrimidine, 4-chloro-2-methyl-6-[4-(phenylmethyl)-1-piperazinyl]-
• 4-Chloro-2-methyl-6-[4-(phenylmethyl)-1-piperazinyl]pyrimidine