CAS 1017782-76-1
:4-(2-Amino-6-chloro-4-pyrimidinyl)-1-piperazineethanol
Description:
4-(2-Amino-6-chloro-4-pyrimidinyl)-1-piperazineethanol is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a piperazine moiety. This substance typically exhibits properties associated with both basic and aromatic functionalities, making it potentially useful in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the amino and chloro groups suggests that it may participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. The piperazine ring contributes to its potential as a central nervous system agent, as piperazine derivatives are often explored for their pharmacological activities. Additionally, the compound's molecular structure may allow for various modifications, enhancing its biological activity or selectivity. Overall, 4-(2-Amino-6-chloro-4-pyrimidinyl)-1-piperazineethanol represents a class of compounds that could be significant in drug discovery and development, particularly in targeting specific biological pathways.
Formula:C10H16ClN5O
InChI:InChI=1S/C10H16ClN5O/c11-8-7-9(14-10(12)13-8)16-3-1-15(2-4-16)5-6-17/h7,17H,1-6H2,(H2,12,13,14)
InChI key:InChIKey=IMQBEKPAFPSBCI-UHFFFAOYSA-N
SMILES:ClC1=CC(N2CCN(CCO)CC2)=NC(N)=N1
Synonyms:- 4-(2-Amino-6-chloro-4-pyrimidinyl)-1-piperazineethanol
- 1-Piperazineethanol, 4-(2-amino-6-chloro-4-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.