CAS 1017788-27-0

α-(Aminomethyl)-3-bromobenzeneacetic acid

Description:

α-(Aminomethyl)-3-bromobenzeneacetic acid, with the CAS number 1017788-27-0, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group, which classifies it as an amino acid derivative. The compound features a bromine atom substituted at the meta position of the benzene ring, contributing to its unique reactivity and potential biological activity. Its structure suggests that it may exhibit polar characteristics due to the presence of the amino and carboxylic acid groups, which can engage in hydrogen bonding. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Additionally, its brominated aromatic structure may impart specific electronic properties, influencing its interactions in chemical reactions. As with many organic compounds, its solubility, stability, and reactivity can vary significantly depending on environmental conditions such as pH and temperature. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₀BrNO₂

InChI: InChI=1S/C9H10BrNO2/c10-7-3-1-2-6(4-7)8(5-11)9(12)13/h1-4,8H,5,11H2,(H,12,13)

InChI key: InChIKey=GVIOMYJBOBTPKQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CN)C1=CC(Br)=CC=C1

Synonyms:

• Benzeneacetic acid, α-(aminomethyl)-3-bromo-
• α-(Aminomethyl)-3-bromobenzeneacetic acid