
CAS 1017789-05-7
:5-Bromo-2-(2-pyridinyloxy)pyrimidine
Description:
5-Bromo-2-(2-pyridinyloxy)pyrimidine is a heterocyclic organic compound characterized by the presence of a bromine atom and a pyridinyloxy group attached to a pyrimidine ring. The compound features a pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3, contributing to its aromaticity and stability. The bromine substituent at position 5 enhances its reactivity, making it suitable for various chemical transformations. The 2-(2-pyridinyloxy) group introduces additional functional properties, allowing for potential interactions in biological systems or as a ligand in coordination chemistry. This compound may exhibit biological activity, particularly in medicinal chemistry, where pyrimidine derivatives are often explored for their pharmacological properties. Its solubility and stability in different solvents can vary, influencing its application in research and industry. Overall, 5-Bromo-2-(2-pyridinyloxy)pyrimidine is a versatile compound with potential uses in drug development and as a building block in organic synthesis.
Formula:C9H6BrN3O
InChI:InChI=1S/C9H6BrN3O/c10-7-5-12-9(13-6-7)14-8-3-1-2-4-11-8/h1-6H
InChI key:InChIKey=FYIDUMKARNVCQY-UHFFFAOYSA-N
SMILES:O(C=1N=CC(Br)=CN1)C2=CC=CC=N2
Synonyms:- 5-Bromo-2-(2-pyridinyloxy)pyrimidine
- Pyrimidine, 5-bromo-2-(2-pyridinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.