CAS 1017789-40-0
:Phenylmethyl 3-amino-4-(hydroxymethyl)-1-pyrrolidinecarboxylate
Description:
Phenylmethyl 3-amino-4-(hydroxymethyl)-1-pyrrolidinecarboxylate, identified by its CAS number 1017789-40-0, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of an amino group and a hydroxymethyl group, which contribute to its potential reactivity and biological activity. The phenylmethyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The carboxylate functional group suggests that it may exhibit acidic properties, which can be relevant in various chemical reactions and biological processes. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets, making it a candidate for further research in drug development or as a biochemical probe. Its specific properties, such as melting point, solubility, and stability, would need to be determined through experimental methods for practical applications.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c14-12-7-15(6-11(12)8-16)13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,16H,6-9,14H2
InChI key:InChIKey=YXCPNFNWSNFFFZ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(CO)C(N)C2
Synonyms:- 1-Pyrrolidinecarboxylic acid, 3-amino-4-(hydroxymethyl)-, phenylmethyl ester
- 1-Cbz-3-Amino-4-hydroxymethylpyrrolidine
- Phenylmethyl 3-amino-4-(hydroxymethyl)-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
