
CAS 1017789-47-7
:N-(2,3-Dimethyl-6-nitrophenyl)-2,2-dimethylpropanamide
Description:
N-(2,3-Dimethyl-6-nitrophenyl)-2,2-dimethylpropanamide is an organic compound characterized by its complex structure, which includes a nitrophenyl group and an amide functional group. The presence of the nitro group indicates potential reactivity and polarity, while the dimethyl groups contribute to steric hindrance, influencing its physical and chemical properties. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic alkyl chains. The amide linkage suggests that it may participate in hydrogen bonding, affecting its boiling and melting points. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1017789-47-7, allows for precise identification in chemical databases, facilitating further studies on its synthesis, reactivity, and potential applications. Overall, this compound's unique structural features position it as a subject of interest in both synthetic and medicinal chemistry.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-8-6-7-10(15(17)18)11(9(8)2)14-12(16)13(3,4)5/h6-7H,1-5H3,(H,14,16)
InChI key:InChIKey=OZYWCQOQNIOIOP-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(N(=O)=O)C=CC(C)=C1C
Synonyms:- N-(2,3-Dimethyl-6-nitrophenyl)-2,2-dimethylpropanamide
- Propanamide, N-(2,3-dimethyl-6-nitrophenyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2,3-Dimethyl-6-nitrophenyl)-2,2-dimethylpropionamide
CAS:Formula:C13H18N2O3Molecular weight:250.2936
