CAS 1017791-27-3

2-Chloro-5-(4H-1,2,4-triazol-4-yl)benzenamine

Description:

2-Chloro-5-(4H-1,2,4-triazol-4-yl)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a triazole moiety. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and solubility. The triazole ring, a five-membered heterocyclic structure containing three nitrogen atoms, contributes to the compound's potential biological activity, often associated with antifungal and antimicrobial properties. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its synthesis often involves multi-step organic reactions, and it may be utilized in various applications, including pharmaceuticals and agrochemicals. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Chloro-5-(4H-1,2,4-triazol-4-yl)benzenamine is of interest in both research and industrial contexts.

Formula: C₈H₇ClN₄

InChI: InChI=1S/C8H7ClN4/c9-7-2-1-6(3-8(7)10)13-4-11-12-5-13/h1-5H,10H2

InChI key: InChIKey=WOHQVUYHPVQGAQ-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1Cl)N2C=NN=C2

Synonyms:

• Benzenamine, 2-chloro-5-(4H-1,2,4-triazol-4-yl)-
• 2-Chloro-5-(4H-1,2,4-triazol-4-yl)benzenamine
• 2-Chloro-5-(4H-1,2,4-triazol-4-yl)aniline