CymitQuimica logo

CAS 1017791-77-3

:

4-Thiomorpholineethanamine, 1-oxide

Description:
4-Thiomorpholineethanamine, 1-oxide is a chemical compound characterized by the presence of a thiomorpholine ring, which is a six-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an amine functional group, contributing to its basicity and potential reactivity in various chemical reactions. The "1-oxide" designation indicates the presence of an oxygen atom bonded to the nitrogen, which can influence the compound's electronic properties and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of sulfur in the thiomorpholine ring can also impart unique properties, such as increased lipophilicity or altered solubility profiles. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 4-Thiomorpholineethanamine, 1-oxide is a versatile compound with potential applications in research and industry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C6H14N2OS
InChI:InChI=1S/C6H14N2OS/c7-1-2-8-3-5-10(9)6-4-8/h1-7H2
InChI key:InChIKey=PRZDBNBUEAQECP-UHFFFAOYSA-N
SMILES:C(CN)N1CCS(=O)CC1
Synonyms:
  • 4-(2-Aminoethyl)thiomorpholine 1-oxide
  • 4-Thiomorpholineethanamine, 1-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.