CymitQuimica logo

CAS 1017791-79-5

:

4-Thiomorpholineacetonitrile, 1-oxide

Description:
4-Thiomorpholineacetonitrile, 1-oxide is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring and a nitrile functional group. This compound typically exhibits properties associated with both heterocyclic compounds and nitriles, such as moderate polarity and potential reactivity due to the presence of the nitrile group. The thiomorpholine moiety contributes to its potential as a nucleophile in various chemical reactions. It may also display specific solubility characteristics, often being soluble in polar organic solvents. The presence of the 1-oxide functional group suggests that it may participate in oxidation-reduction reactions, influencing its reactivity and stability. Additionally, compounds like this can be of interest in medicinal chemistry and material science due to their potential biological activity and utility in synthesizing other complex molecules. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C6H10N2OS
InChI:InChI=1S/C6H10N2OS/c7-1-2-8-3-5-10(9)6-4-8/h2-6H2
InChI key:InChIKey=CMZGFFNFFOTGOL-UHFFFAOYSA-N
SMILES:C(C#N)N1CCS(=O)CC1
Synonyms:
  • 4-Thiomorpholineacetonitrile, 1-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.