CAS 1017793-21-3: Pyridine, 4-bromo-3-chloro-2-fluoro-

Description:Pyridine, 4-bromo-3-chloro-2-fluoro- is a halogenated derivative of pyridine, characterized by the presence of bromine, chlorine, and fluorine substituents on the aromatic ring. This compound features a six-membered heterocyclic structure containing one nitrogen atom, which contributes to its basicity and potential reactivity. The specific arrangement of the halogen atoms at the 4, 3, and 2 positions influences its chemical properties, such as polarity, solubility, and reactivity in nucleophilic substitution reactions. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of multiple halogens can enhance the compound's reactivity and may impart unique biological activities. Additionally, the compound's physical properties, such as boiling point and melting point, are influenced by the halogen substituents, which can affect intermolecular interactions. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula:C₅H₂BrClFN

InChI:InChI=1S/C5H2BrClFN/c6-3-1-2-9-5(8)4(3)7/h1-2H

InChI key:InChIKey=UMQBGWKWOLRROL-UHFFFAOYSA-N

SMILES:FC1=NC=CC(Br)=C1Cl

Synonyms:
4-Bromo-3-chloro-2-fluoropyridine
Pyridine, 4-bromo-3-chloro-2-fluoro-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Bromo-3-chloro-2-fluoropyridine, 98% REF: 02-H64362CAS: 1017793-21-3	98%	To inquire	Fri 18 Jul 25
Pyridine, 4-bromo-3-chloro-2-fluoro- REF: IN-DA0005KICAS: 1017793-21-3	98%	To inquire	Thu 24 Jul 25
4-Bromo-3-chloro-2-fluoropyridine REF: 54-PC904659CAS: 1017793-21-3	0.98	32.00 €~1,873.00 €	Fri 25 Jul 25
4-Bromo-3-chloro-2-fluoro-pyridine REF: 10-F044855CAS: 1017793-21-3	97.0%	27.00 €~1,211.00 €	Tue 29 Jul 25
4-Bromo-3-chloro-2-fluoropyridine REF: 3D-FB178394CAS: 1017793-21-3	Min. 95%	- - -	Discontinued product