CAS 1017793-22-4

2,3-Difluoro-5-iodo-4-pyridinecarboxylic acid

Description:

2,3-Difluoro-5-iodo-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with fluorine atoms and at the 5 position with an iodine atom. The presence of the carboxylic acid functional group at the 4 position contributes to its acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its unique halogen substitutions can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The fluorine atoms can enhance the compound's lipophilicity and stability, while the iodine atom may facilitate certain types of reactions due to its larger size and lower electronegativity. Overall, 2,3-Difluoro-5-iodo-4-pyridinecarboxylic acid is of interest in medicinal chemistry and materials science for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₆H₂F₂INO₂

InChI: InChI=1S/C6H2F2INO2/c7-4-3(6(11)12)2(9)1-10-5(4)8/h1H,(H,11,12)

InChI key: InChIKey=NIOGXXMBPXLMPB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(F)=C(F)N=CC1I

Synonyms:

• 2,3-Difluoro-5-iodo-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2,3-difluoro-5-iodo-