CymitQuimica logo

CAS 1017794-50-1

:

2-Pyrimidinemethanesulfonyl chloride

Description:
2-Pyrimidinemethanesulfonyl chloride is an organic compound characterized by the presence of a pyrimidine ring and a sulfonyl chloride functional group. Its molecular structure features a pyrimidine moiety, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions, attached to a methanesulfonyl chloride group. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonamide functionalities into various substrates. Additionally, it may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its applications can extend to pharmaceuticals and agrochemicals, where it serves as an intermediate in the synthesis of more complex molecules.
Formula:C5H5ClN2O2S
InChI:InChI=1S/C5H5ClN2O2S/c6-11(9,10)4-5-7-2-1-3-8-5/h1-3H,4H2
InChI key:InChIKey=PQVJXGWFBWURJP-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C=1N=CC=CN1
Synonyms:
  • 2-Pyrimidinemethanesulfonyl chloride
  • (Pyrimidin-2-yl)methanesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.