
CAS 1017795-12-8
:2-(1H-Pyrazol-1-yl)-5-pyrimidinemethanamine
Description:
2-(1H-Pyrazol-1-yl)-5-pyrimidinemethanamine is an organic compound characterized by its unique structural features, which include a pyrazole ring and a pyrimidine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of amino and heterocyclic groups. Its molecular structure suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. The presence of both pyrazole and pyrimidine rings indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often associated with bioactive compounds. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(1H-Pyrazol-1-yl)-5-pyrimidinemethanamine represents a versatile scaffold for further chemical modifications and investigations in various fields, including drug discovery and material science.
Formula:C8H9N5
InChI:InChI=1S/C8H9N5/c9-4-7-5-10-8(11-6-7)13-3-1-2-12-13/h1-3,5-6H,4,9H2
InChI key:InChIKey=ZMDZZRPDPJPPQR-UHFFFAOYSA-N
SMILES:C(N)C=1C=NC(=NC1)N2C=CC=N2
Synonyms:- 5-Pyrimidinemethanamine, 2-(1H-pyrazol-1-yl)-
- 2-(1H-Pyrazol-1-yl)-5-pyrimidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.