CAS 10178-57-1
:7-bromo-2,2-dimethyl-2,3-dihydro-1-benzofuran
Description:
7-Bromo-2,2-dimethyl-2,3-dihydro-1-benzofuran is an organic compound characterized by its unique bicyclic structure, which combines elements of both furan and benzene rings. The presence of a bromine atom at the 7-position introduces notable reactivity, making it a potential candidate for various chemical transformations. The two methyl groups at the 2-position contribute to its steric hindrance, influencing its physical and chemical properties, such as boiling point and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on the specific conditions. It is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo electrophilic substitution reactions. Additionally, the dihydrobenzofuran moiety can exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 7-bromo-2,2-dimethyl-2,3-dihydro-1-benzofuran is a versatile compound with significant implications in chemical synthesis and research.
Formula:C10H11BrO
InChI:InChI=1/C10H11BrO/c1-10(2)6-7-4-3-5-8(11)9(7)12-10/h3-5H,6H2,1-2H3
SMILES:CC1(C)Cc2cccc(c2O1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.