
CAS 1017802-87-7
:Ethyl 3-(acetylamino)-5-bromo-1H-pyrazole-4-carboxylate
Description:
Ethyl 3-(acetylamino)-5-bromo-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features an ethyl ester functional group, an acetylamino substituent, and a bromo group, contributing to its reactivity and potential biological activity. The presence of the acetylamino group suggests that it may participate in various chemical reactions, such as acylation or amidation. The bromine atom introduces a halogen, which can enhance the compound's electrophilicity and may influence its interactions with biological targets. Ethyl 3-(acetylamino)-5-bromo-1H-pyrazole-4-carboxylate may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its unique structure positions it as a candidate for research in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many pyrazole derivatives, it may possess interesting pharmacological properties, warranting further investigation into its potential applications.
Formula:C8H10BrN3O3
InChI:InChI=1S/C8H10BrN3O3/c1-3-15-8(14)5-6(9)11-12-7(5)10-4(2)13/h3H2,1-2H3,(H2,10,11,12,13)
InChI key:InChIKey=UPIXCTDPJSRTSW-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C(C(OCC)=O)=C(Br)NN1
Synonyms:- Ethyl 3-(acetylamino)-5-bromo-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 3-(acetylamino)-5-bromo-, ethyl ester
- 3-Acetylamino-5-bromo-1H-pyrazole-4-carboxylic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.