CymitQuimica logo

CAS 1017802-90-2

:

Ethyl 3-amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylate

Description:
Ethyl 3-amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylate functional group, contributing to its acidic properties, and an ethyl ester moiety, which enhances its solubility in organic solvents. The presence of a bromine atom at the 5-position and an amino group at the 3-position of the pyrazole ring introduces specific reactivity and potential for further chemical modifications. The methyl group at the 1-position adds to the compound's steric properties. This compound is of interest in medicinal chemistry and agricultural applications due to its potential biological activity. Its molecular structure allows for various interactions, making it a candidate for further research in drug development and synthesis of novel materials. As with many pyrazole derivatives, it may exhibit diverse pharmacological properties, including anti-inflammatory or antimicrobial activities, depending on the specific substituents and their arrangement.
Formula:C7H10BrN3O2
InChI:InChI=1S/C7H10BrN3O2/c1-3-13-7(12)4-5(8)11(2)10-6(4)9/h3H2,1-2H3,(H2,9,10)
InChI key:InChIKey=CQQQEMOVJDFHPL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Br)N(C)N=C1N
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 3-amino-5-bromo-1-methyl-, ethyl ester
  • 3-Amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester
  • Ethyl 3-amino-5-bromo-1-methyl-1H-pyrazole-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.