CAS 10179-89-2
:8-(trifluoromethyl)-7H-purin-2-amine
Description:
8-(Trifluoromethyl)-7H-purin-2-amine, with the CAS number 10179-89-2, is a purine derivative characterized by the presence of a trifluoromethyl group at the 8-position of the purine ring and an amino group at the 2-position. This compound exhibits properties typical of purines, including potential biological activity, as purines are fundamental components of nucleic acids and play crucial roles in cellular processes. The trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets, potentially affecting its pharmacological properties. The presence of the amino group may also contribute to hydrogen bonding capabilities, which can be significant in molecular recognition and binding interactions. This compound is of interest in medicinal chemistry and may be explored for its potential applications in drug development, particularly in the context of targeting specific biological pathways or receptors. As with many fluorinated compounds, it may exhibit unique stability and reactivity characteristics, making it a subject of study in various chemical and biological contexts.
Formula:C6H4F3N5
InChI:InChI=1/C6H4F3N5/c7-6(8,9)4-12-2-1-11-5(10)14-3(2)13-4/h1H,(H3,10,11,12,13,14)
SMILES:c1c2c(nc(C(F)(F)F)n2)[nH]c(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
