CAS 1017962-38-7

rel-[(1R,2S)-2-(Bromomethyl)cyclopropyl]benzene

Description:

Rel-[(1R,2S)-2-(Bromomethyl)cyclopropyl]benzene is a chemical compound characterized by its unique structure, which includes a cyclopropyl ring and a bromomethyl substituent. The compound features a chiral center, contributing to its stereoisomerism, specifically in the (1R,2S) configuration. This stereochemistry can influence its reactivity and interactions with biological systems. The presence of the bromomethyl group enhances its potential for nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the benzene ring provides aromatic stability and can participate in electrophilic aromatic substitution reactions. The compound's physical properties, such as boiling point and solubility, are influenced by its molecular structure and functional groups. Overall, rel-[(1R,2S)-2-(Bromomethyl)cyclopropyl]benzene is significant in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, where its unique structural features can be exploited for specific applications.

Formula: C₁₀H₁₁Br

InChI: InChI=1/C10H11Br/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2/t9-,10+/s2

InChI key: InChIKey=QYDBZVRKADDLFQ-NLJMKPLXNA-N

SMILES: C(Br)[C@@H]1[C@@H](C1)C2=CC=CC=C2

Synonyms:

• rel-[(1R,2S)-2-(Bromomethyl)cyclopropyl]benzene
• Benzene, [(1R,2S)-2-(bromomethyl)cyclopropyl]-, rel-