CAS 101798-65-6
:4-(Phenylthio)piperidine
Description:
4-(Phenylthio)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a phenylthio group at the fourth position of the piperidine ring introduces a sulfur atom bonded to a phenyl group, contributing to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound may exhibit moderate to high lipophilicity, influencing its solubility and permeability in biological systems. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, owing to the functional groups present. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H15NS
InChI:InChI=1S/C11H15NS/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11-12H,6-9H2
InChI key:InChIKey=CMFUYNUDGNDTGC-UHFFFAOYSA-N
SMILES:S(C1=CC=CC=C1)C2CCNCC2
Synonyms:- Piperidine, 4-(phenylthio)-
- 4-Phenylsulfanylpiperidine
- 4-(Phenylthio)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.