CAS 101798-77-0

Piperidine, 2-[[(4-chlorophenyl)thio]methyl]-

Description:

Piperidine, 2-[[(4-chlorophenyl)thio]methyl]- is an organic compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a thioether functional group, where a sulfur atom is bonded to a methyl group and a 4-chlorophenyl group, indicating the presence of a chlorine substituent on the phenyl ring. This structure contributes to its potential reactivity and biological activity. The presence of the piperidine moiety often suggests applications in medicinal chemistry, as piperidine derivatives are known for their pharmacological properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents and limited solubility in water are common characteristics of such compounds. Safety data should be consulted for handling, as compounds with halogenated aromatic groups can exhibit toxicity or environmental concerns. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₆ClNS

InChI: InChI=1S/C12H16ClNS/c13-10-4-6-12(7-5-10)15-9-11-3-1-2-8-14-11/h4-7,11,14H,1-3,8-9H2

InChI key: InChIKey=CXQIPUMYBSVOBJ-UHFFFAOYSA-N

SMILES: S(CC1CCCCN1)C2=CC=C(Cl)C=C2

Synonyms:

• 2-(((4-Chlorophenyl)thio)methyl)piperidine
• 2-[[(4-Chlorophenyl)sulfanyl]methyl]piperidine
• Piperidine, 2-[[(4-chlorophenyl)thio]methyl]-