CymitQuimica logo

CAS 101798-82-7

:

Piperidine, 3-[(phenylthio)methyl]-, hydrochloride (1:1)

Description:
Piperidine, 3-[(phenylthio)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a phenylthio group attached to the third carbon of the piperidine ring, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, which could lead to various therapeutic effects. The presence of the phenylthio moiety may also influence its lipophilicity and permeability, important factors in drug design. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, Piperidine, 3-[(phenylthio)methyl]-, hydrochloride (1:1) represents a versatile compound with implications in research and development within the chemical and pharmaceutical fields.
Formula:C12H17NS·ClH
InChI:InChI=1S/C12H17NS.ClH/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11;/h1-3,6-7,11,13H,4-5,8-10H2;1H
InChI key:InChIKey=YVEVHEHUBBVHHA-UHFFFAOYSA-N
SMILES:C(SC1=CC=CC=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-[(phenylthio)methyl]-, hydrochloride
  • Piperidine, 3-[(phenylthio)methyl]-, hydrochloride (1:1)
  • 3-[(Phenylsulfanyl)methyl]piperidine hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.