
CAS 1018-34-4
:Pyrrolidinium, 1,1-dimethyl-2-[[2-(trimethylammonio)ethoxy]carbonyl]-, iodide (1:2)
Description:
Pyrrolidinium, 1,1-dimethyl-2-[[2-(trimethylammonio)ethoxy]carbonyl]-, iodide (1:2), with CAS number 1018-34-4, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a pyrrolidinium ring, which contributes to its cyclic structure and potential for forming stable interactions with various anions. The presence of the trimethylammonio group enhances its solubility in polar solvents, making it useful in various applications, including as a surfactant or in ionic liquids. The iodide counterion plays a crucial role in its stability and reactivity. Additionally, the ethoxycarbonyl group introduces a carbonyl functionality that can participate in further chemical reactions, potentially influencing its reactivity and interactions with other molecules. Overall, this compound exhibits properties typical of ionic liquids, such as low volatility and thermal stability, making it of interest in fields like materials science, electrochemistry, and pharmaceuticals.
Formula:C12H26N2O2·2I
InChI:InChI=1S/C12H26N2O2.2HI/c1-13(2,3)9-10-16-12(15)11-7-6-8-14(11,4)5;;/h11H,6-10H2,1-5H3;2*1H/q+2;;/p-2
InChI key:InChIKey=CODSEWNHIHYVHK-UHFFFAOYSA-L
SMILES:C(OCC[N+](C)(C)C)(=O)C1[N+](C)(C)CCC1.[I-]
Synonyms:- Pyrrolidinium, 2-carboxy-1,1-dimethyl-, iodide, ester with choline iodide
- Pyrrolidinium, 1,1-dimethyl-2-[[2-(trimethylammonio)ethoxy]carbonyl]-, iodide (1:2)
- 2-Carboxy-1,1-dimethylpyrrolidinium iodide, ester with choline iodide
- Pyrrolidinium, 1,1-dimethyl-2-[[2-(trimethylammonio)ethoxy]carbonyl]-, diiodide
- Choline, iodide, ester with 2-carboxy-1,1-dimethylpyrrolidinium iodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pyrrolidinium, 1,1-dimethyl-2-[[2-(trimethylammonio)ethoxy]carbonyl]-, iodide (1:2)
CAS:Formula:C12H26IN2O2Molecular weight:357.2515Trepirium iodide
CAS:Trepirium iodide is a Ganglioblokator.Formula:C12H26I2N2O2Color and Shape:SolidMolecular weight:484.16

