
CAS 1018051-53-0
:Methyl 1-[2-(cyclopentylamino)-2-oxoethyl]-3,6-dicyclopropyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
Description:
Methyl 1-[2-(cyclopentylamino)-2-oxoethyl]-3,6-dicyclopropyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a complex organic compound characterized by its unique structural features, including a pyrazolo-pyridine core and multiple cyclopropyl and cyclopentyl substituents. This compound typically exhibits properties such as moderate to high lipophilicity due to its hydrophobic cyclopropyl groups, which may influence its bioavailability and interaction with biological membranes. The presence of the carboxylate functional group suggests potential for hydrogen bonding and reactivity, which could be relevant in medicinal chemistry applications. Additionally, the compound may display specific pharmacological activities, potentially acting as an inhibitor or modulator in various biological pathways. Its molecular structure indicates potential for diverse interactions with proteins or enzymes, making it a candidate for further investigation in drug development. However, detailed studies on its solubility, stability, and biological activity would be necessary to fully characterize its potential applications in pharmaceuticals or other fields.
Formula:C21H26N4O3
InChI:InChI=1S/C21H26N4O3/c1-28-21(27)15-10-16(12-6-7-12)23-20-18(15)19(13-8-9-13)24-25(20)11-17(26)22-14-4-2-3-5-14/h10,12-14H,2-9,11H2,1H3,(H,22,26)
InChI key:InChIKey=ODOUFIWSTXJESS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(N(CC(NC3CCCC3)=O)N=C2C4CC4)=NC(=C1)C5CC5
Synonyms:- Methyl 1-[2-(cyclopentylamino)-2-oxoethyl]-3,6-dicyclopropyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
- 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-[2-(cyclopentylamino)-2-oxoethyl]-3,6-dicyclopropyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.