CAS 1018052-92-0

1-[2-(Cyclohexylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

1-[2-(Cyclohexylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a complex organic compound characterized by its unique structural features, including a pyrazolo[3,4-b]pyridine core, which contributes to its potential biological activity. The presence of a cyclohexylamino group and a cyclopropyl moiety suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a modulator of specific biological pathways. The carboxylic acid functional group indicates potential for hydrogen bonding and solubility in polar solvents, which can influence its bioavailability and interaction with biological targets. Additionally, the methyl group at the 6-position of the pyrazolo ring may affect the compound's sterics and electronic properties, potentially enhancing its activity. Overall, this compound's intricate structure suggests it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications in drug development.

Formula: C₁₉H₂₄N₄O₃

InChI: InChI=1S/C19H24N4O3/c1-11-9-14(19(25)26)16-17(12-7-8-12)22-23(18(16)20-11)10-15(24)21-13-5-3-2-4-6-13/h9,12-13H,2-8,10H2,1H3,(H,21,24)(H,25,26)

InChI key: InChIKey=TWAHXKPHTCNECS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NN(CC(NC3CCCCC3)=O)C2=NC(C)=C1)C4CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-[2-(cyclohexylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-
• 1-[2-(Cyclohexylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid