CAS 1018053-32-1
:2,4-Dihydro-5-methyl-4-(propylamino)-3H-1,2,4-triazole-3-thione
Description:
2,4-Dihydro-5-methyl-4-(propylamino)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a propylamino group suggests that it may exhibit amine-like properties, which can influence its solubility and interaction with biological systems. The methyl group at the 5-position of the triazole ring can also affect the compound's steric and electronic properties. This compound may be of interest in agricultural or pharmaceutical applications, particularly as a potential herbicide or fungicide, due to its structural characteristics that can interact with biological targets. Its specific physical and chemical properties, such as solubility, melting point, and stability, would need to be determined through experimental methods for practical applications.
Formula:C6H12N4S
InChI:InChI=1S/C6H12N4S/c1-3-4-7-10-5(2)8-9-6(10)11/h7H,3-4H2,1-2H3,(H,9,11)
InChI key:InChIKey=DBBFZDQQJDWSKD-UHFFFAOYSA-N
SMILES:N(CCC)N1C(C)=NNC1=S
Synonyms:- 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-methyl-4-(propylamino)-
- 2,4-Dihydro-5-methyl-4-(propylamino)-3H-1,2,4-triazole-3-thione
- 5-Methyl-4-(propylamino)-4H-1,2,4-triazole-3-thiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.