
CAS 1018053-40-1
:Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate
Description:
Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a trifluoromethyl group. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. Ethyl esters, like this one, are often used in organic synthesis and can serve as intermediates in the development of pharmaceuticals. The carboxylate functional group contributes to the compound's reactivity, allowing for further derivatization. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which may lead to various therapeutic applications. Its stability and solubility in organic solvents are also notable characteristics, making it suitable for various chemical reactions and formulations. Overall, this compound represents a significant class of heterocyclic compounds with potential implications in drug discovery and development.
Formula:C10H8F3N3O2
InChI:InChI=1S/C10H8F3N3O2/c1-2-18-9(17)6-5-7(10(11,12)13)16-8(15-6)3-4-14-16/h3-5H,2H2,1H3
InChI key:InChIKey=NNNDBTVQJNAJJN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N2C(N=C(C(OCC)=O)C1)=CC=N2
Synonyms:- Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 7-(trifluoromethyl)-, ethyl ester
- Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.