
CAS 10181-37-0
:3-Acridinamine, 9-(4-aminophenyl)-, nitrate (1:1)
Description:
3-Acridinamine, 9-(4-aminophenyl)-, nitrate (1:1), with the CAS number 10181-37-0, is a chemical compound characterized by its acridine and aniline derivatives. This substance typically exhibits properties associated with both aromatic amines and nitrated compounds, which may influence its solubility, stability, and reactivity. The presence of the acridine moiety suggests potential applications in biological systems, particularly in medicinal chemistry, due to its ability to intercalate with nucleic acids. The nitrate group may impart additional properties, such as increased solubility in polar solvents and potential for forming salts. As with many compounds containing amine groups, it may exhibit basicity and can participate in various chemical reactions, including electrophilic substitutions. Safety considerations are paramount, as compounds with similar structures can be associated with toxicity and mutagenicity. Therefore, handling this compound requires appropriate safety measures, including the use of personal protective equipment and adherence to regulatory guidelines. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C19H15N3·HNO3
InChI:InChI=1S/C19H15N3.HNO3/c20-13-7-5-12(6-8-13)19-15-3-1-2-4-17(15)22-18-11-14(21)9-10-16(18)19;2-1(3)4/h1-11H,20-21H2;(H,2,3,4)
InChI key:InChIKey=QOXAQWDBAHKGBG-UHFFFAOYSA-N
SMILES:N(=O)(=O)O.NC1=CC2=C(C(=C3C(=N2)C=CC=C3)C4=CC=C(N)C=C4)C=C1
Synonyms:- 9-(4-Aminophenyl)acridin-3-amine nitrate
- Acridine, 3-amino-9-(p-aminophenyl)-, mononitrate
- 3-Acridinamine, 9-(4-aminophenyl)-, mononitrate
- 3-Acridinamine, 9-(4-aminophenyl)-, nitrate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
