
CAS 1018127-54-2
:4-Amino-6-nitro-3-quinolinecarboxylic acid
Description:
4-Amino-6-nitro-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an amino group (-NH2) and a nitro group (-NO2) at specific positions on the quinoline ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and allows for further derivatization. The presence of both amino and nitro groups suggests that this compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Its unique structure may also impart biological activity, making it a candidate for research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the nitro group can be sensitive to reduction reactions, and the compound may exhibit toxicity. Overall, 4-Amino-6-nitro-3-quinolinecarboxylic acid is a versatile compound with potential applications in research and industry.
Formula:C10H7N3O4
InChI:InChI=1S/C10H7N3O4/c11-9-6-3-5(13(16)17)1-2-8(6)12-4-7(9)10(14)15/h1-4H,(H2,11,12)(H,14,15)
InChI key:InChIKey=MGJCQIPPSDGTAD-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=CC1C(O)=O)C=CC(N(=O)=O)=C2
Synonyms:- 3-Quinolinecarboxylic acid, 4-amino-6-nitro-
- 4-Amino-6-nitro-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.